Azathioprine 25mg
Azathioprine inhibits an enzyme that is required for the synthesis of DNA, thus most strongly affects proliferating cells, such as the T cells and B cells of the immune system.
Trivial name | Azathioprine 25mg |
Catalog Number | A10107-25 |
Alternative Name(s) | 6-[(1-methyl-4-nitro-1H-imidazol-5-yl)sulfanyl]-7H-purine |
Molecular Formula | C9H7N7O2S |
CAS# | 446-86-6 |
SMILES | CN1C=NC(=C1SC2=NC=NC3=C2NC=N3)[N+](=O)[O-] |
Size | 25mg |
Supplier Page | http://www.adooq.com/azathioprine.html |