Azathioprine 200mg
Azathioprine inhibits an enzyme that is required for the synthesis of DNA, thus most strongly affects proliferating cells, such as the T cells and B cells of the immune system.
| Trivial name | Azathioprine 200mg |
| Catalog Number | A10107-200 |
| Alternative Name(s) | 6-[(1-methyl-4-nitro-1H-imidazol-5-yl)sulfanyl]-7H-purine |
| Molecular Formula | C9H7N7O2S |
| CAS# | 446-86-6 |
| SMILES | CN1C=NC(=C1SC2=NC=NC3=C2NC=N3)[N+](=O)[O-] |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/azathioprine.html |
