Cyclopamine
Cyclopamine (11-deoxojervine) is a specific Hedgehog (Hh) signaling pathway antagonist of Smoothened (Smo) with IC50 of 46 nM in TM3Hh12 cells.
| Trivial name | 11-deoxojervine |
| Catalog Number | S1146 |
| Molecular Formula | C21H20N4O |
| CAS# | 4449-51-8 |
| Inchi | InChI=1S/C21H20N4O/c1-2-7-17(8-3-1)10-11-19-21(26-16-15-25-13-4-5-14-25)24-18-9-6-12-22-20(18)23-19/h1-3,6-9,12H,4-5,13-16H2 |
| Inchi Key | MNYJJHBAEYKXEG-UHFFFAOYSA-N |
| SMILES | C1CCN(C1)CCOC2=NC3=C(N=CC=C3)N=C2C#CC4=CC=CC=C4 |
| Size | 50mg |
| Supplier Page | http://www.selleckchem.com/products/Cyclopamine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/Cyclopamine-chemical-structure-S1146.gif |
