Pazopanib
API Standard
| Catalog Number | CS-O-02101 |
| Alternative Name(s) | 5-((4-((2,3-dimethyl-2H-indazol-6-yl)(methyl)amino)pyrimidin-2-yl)amino)-2-methylbenzenesulfonamide;GW786034; UNII-7RN5D 790713-33-6. |
| Research Area | Pazopanib is a Kinase Inhibitor. The mechanism of action of pazopanib is as a Protein Kinase Inhibitor, and Cytochrome P450 3A4 Inhibitor, and Cytochrome P450 2D6 Inhibitor, and Cytochrome P450 2C8 Inhibitor. |
| Molecular Formula | C21H23N7O2S |
| CAS# | 444731-52-6 |
| Purity | >98% |
| SMILES | CC1=C(C=CC(N(C2=NC(NC3=CC([S](N)(=O)=O)=C(C)C=C3)=NC=C2)C)=C4)C4=NN1C |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02101.html |