JNJ-7706621 10mM * 1mL in DMSO
JNJ-7706621 is a novel cell cycle inhibitor that showed potent inhibition of several cyclin-dependent kinases (CDK) and Aurora kinases.
| Trivial name | JNJ-7706621 10mM * 1mL in DMSO |
| Catalog Number | A10494-10mM-D |
| Alternative Name(s) | 4-[[5-Amino-1-(2,6-difluorobenzoyl)-1h-1,2,4-triazol-3-yl]amino]benzenesulfonamide |
| Molecular Formula | C15H12F2N6O3S |
| CAS# | 443797-96-4 |
| SMILES | C1=CC(=C(C(=C1)F)C(=O)N2C(=NC(=N2)NC3=CC=C(C=C3)S(=O)(=O)N)N)F |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/jnj-7706621.html |
