CDDO-Im
CDDO-Im is a synthetic triterpenoid more potent than its parent compound CDDO both in vitro and in vivo and a PPARγ agonist.
| Trivial name | RTA-403; TP 235; CDDO Imidazolide |
| Catalog Number | CSN18278 |
| Alternative Name(s) | RTA-403; TP 235; CDDO Imidazolide |
| Research Area | Cancer |
| Molecular Formula | C34H43N3O3 |
| CAS# | 443104-02-7 |
| Purity | ≥98% |
| SMILES | CC(C)([C@]1([H])CC[C@@]([C@@]2(CC[C@]3(CCC(C)(C[C@@]3([H])[C@]24[H])C)C(N5C=CN=C5)=O)C)6C)C(C(C#N)=C[C@]1(C)C6=CC4=O)=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/cddo-im.html |