Xanthinol Nicotinate
Xanthinol Nicotinate (Complamin, Angioamin) is a potent vasodilator that can easily pass through the cell membrane and once inside the cell it causes an increase in glucose metabolism resulting in an increased energy.
| Trivial name | Complamin, Angioamin |
| Catalog Number | S4868 |
| Molecular Formula | C22H22O4 |
| CAS# | 437-74-1 |
| SMILES | CCCC1=C(C(=C(C2=C1C=C(C(=C2)CC3=CC=CC=C3)C)C(=O)O)O)O |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/xanthinol-nicotinate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/xanthinol-nicotinate-chemical-structure-s4868.gif |
