(+)-Fangchinoline
Fangchinoline ((+)-Limacine, Tetrandrine B, Hanfangichin B) is a phytochemical that has been shown to elicit anti-cancer effects in prostate and breast cancer cell lines via inducing G1 cell cycle arrest. It has also been shown to possess neuroprotective activity.
| Trivial name | (+)-Limacine, Tetrandrine B, Hanfangichin B |
| Catalog Number | S3611 |
| Molecular Formula | C18H15N5O6S2 |
| CAS# | 436-77-1 |
| Inchi | InChI=1S/C18H15N5O6S2/c1-29-18-17(19-10-11-20-18)22-31(27,28)14-6-2-12(3-7-14)21-15(24)8-4-13-5-9-16(30-13)23(25)26/h2-11H,1H3,(H,19,22)(H,21,24)/b8-4+ |
| Inchi Key | FNPPHVLYVGMZMZ-XBXARRHUSA-N |
| SMILES | COC1=NC=CN=C1NS(=O)(=O)C2=CC=C(C=C2)NC(=O)C=CC3=CC=C(S3)[N+](=O)[O-] |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/s-s-fangchinoline.html |
| Additional Information | https://file.selleck.cn/downloads/struct/fangchinoline-chemical-structure-s3611.gif |
