D-α-Tocopherol Succinate
D-α-tocopherol succinate (Vitamin E succinate) is an antioxidant tocopherol and a salt form of vitamin E that significantly reduces the cisplatin-induced increase of ROS and decreases cellular necrosis and late apoptosis, thereby inhibiting cisplatin-induced cytotoxicity in HEIOC1 cells. It also exhibits an anti-apoptotic effect.
| Trivial name | Vitamin E succinate |
| Catalog Number | E7174 |
| Molecular Formula | C21H15N3O4 |
| CAS# | 4345-03-3 |
| Inchi | InChI=1S/C21H15N3O4/c25-17-7-3-1-5-15(17)19-22-20(16-6-2-4-8-18(16)26)24(23-19)14-11-9-13(10-12-14)21(27)28/h1-12,25-26H,(H,27,28) |
| Inchi Key | BOFQWVMAQOTZIW-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NN(C(=N2)C3=CC=CC=C3O)C4=CC=C(C=C4)C(=O)O)O |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/d-alpha-tocopherol-succinate.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E7174-D-a-Tocopherol-Succinate-chemical-structure.png |
