Dacarbazine 200mg
Dacarbazine is an antineoplastic chemotherapy drug used in the treatment of various cancersDacarbazine is a member of the class of alkylating agents, which destroy cancer cells by adding an alkyl group (CnH2n+1) to its DNA.
| Trivial name | Dacarbazine 200mg |
| Catalog Number | A10281-200 |
| Alternative Name(s) | 5-(3,3-Dimethyl-1-triazenyl)imidazole-4-carboxamide |
| Molecular Formula | C6H10N6O |
| CAS# | 4342-03-4 |
| SMILES | CN(C)N/N=C/1C(=NC=N1)C(=O)N |
| Size | 200mg |
| Supplier Page | http://www.adooq.com/dacarbazine.html |