Lithocholic acid 10mM * 1mL in DMSO
Lithocholic acid is a bile acid that acts as a detergent to solubilize fats for absorption.
Trivial name | Lithocholic acid 10mM * 1mL in DMSO |
Catalog Number | A12547-10mM-D |
Alternative Name(s) | 5??-Cholanic Acid-3??-ol |
Molecular Formula | C24H40O3 |
CAS# | 434-13-9 |
SMILES | C[C@H](CCC(=O)O)[C@H]1CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2CC[C@H]4[C@@]3(CC[C@H](C4)O)C)C |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/lithocholic-acid.html |