3-O-Acetyloleanolic Acid
3-O-Acetyloleanolic Acid exhibits anti-angiogenic effects and induces apoptosis in HUVECs and HCT-116 cells, it is a natural product isolated and purified from the herbs of Phytolacca americana.
| Trivial name | / |
| Catalog Number | CSN13311 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C32H50O4 |
| CAS# | 4339-72-4 |
| Purity | ≥95% |
| SMILES | CC1(C)[C@H](CC[C@]2(C)[C@@]3([H])CC=C4[C@]5([H])CC(C)(C)CC[C@@](C(O)=O)5CC[C@](C)4[C@@](C)3CC[C@@]12[H])OC(C)=O |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/3-o-acetyloleanolic-acid.html |
