Formoterol D6 fumarate
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-02939 |
| Alternative Name(s) | 73573-87-2;(R*,R*)-(±)-N-[2-Hydroxy-5-[1-hydroxy-2-[[2-(4-methoxyphenyl)-1-methylethyl]amino]ethyl]phenyl]-formamide (E)-2-Butenedioate (2:1) (Salt) |
| Research Area | Labeled Formoterol, intended for use as an internal standard for the quantification of Formoterol by GC- or LC-mass spectrometry. |
| Molecular Formula | C42H40D12N4O12 |
| CAS# | 43229-80-7 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | OC(/C=C/C(O)=O)=O.O[C@@H](C1=CC(NC=O)=C(O)C=C1)CNC([2H])(C([2H])([2H])[2H])C([2H])([2H])C2=CC=C(OC)C=C2.O[C@@H](C3=CC(NC=O)=C(O)C=C3)CNC([2H])(C([2H])([2H])[2H])C([2H])([2H])C4=CC=C(OC)C=C4 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02939.html |
| Additional Information | NULL |