Cladribine
Cladribine is an adenosine deaminase inhibitor used to treat hairy cell leukemia and multiple sclerosis. For U266, RPMI8226, and MM1.S cells, its IC50 are approximately 2.43 μM, 0.75 μM, and 0.18 μM, respectively.
| Trivial name | 2-CdA; 2-Chlorodeoxyadenosine; 2-Chloro-2′-Deoxyadenosine; CldAdo |
| Catalog Number | CSN10004 |
| Alternative Name(s) | 2-CdA; 2-Chlorodeoxyadenosine; 2-Chloro-2′-Deoxyadenosine; CldAdo |
| Research Area | Cancer |
| Molecular Formula | C10H12ClN5O3 |
| CAS# | 4291-63-8 |
| Purity | ≥99% |
| SMILES | [C@@H]3([N]2C1=C(C(=NC(=N1)Cl)N)N=C2)O[C@H](CO)[C@H](C3)O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/cladribine.html |