Cladribine 100mg
Cladribine is a synthetic anti-cancer agent that mimics the nucleoside adenosine and thus inhibits the enzyme adenosine deaminase, which interferes with the cell’s ability to process DNA.
| Trivial name | Cladribine 100mg |
| Catalog Number | A10223-100 |
| Alternative Name(s) | 5-(6-amino-2-chloro-purin-9-yl)-2-(hydroxymethyl)oxolan-3-ol |
| Molecular Formula | C10H12ClN5O3 |
| CAS# | 4291-63-8 |
| SMILES | C1[C@@H]([C@H](O[C@H]1N2C=NC3=C2N=C(N=C3N)Cl)CO)O |
| Size | 100mg |
| Supplier Page | http://www.adooq.com/cladribine.html |
