Cyproterone acetate 10mM * 1mL in DMSO
Cyproterone acetate is a synthetic derivative of 17-hydroxyprogesterone, and acts as an androgen receptor antagonist as well as a weak progesterone receptor agonist with weak progestational and glucocorticoid activity.
| Trivial name | Cyproterone acetate 10mM * 1mL in DMSO |
| Catalog Number | A11409-10mM-D |
| Alternative Name(s) | 6-chloro-17-hydroxy-1??,2??-methylenepregna-4,6-diene-3,20-dione |
| Molecular Formula | C24H29ClO4 |
| CAS# | 427-51-0 |
| SMILES | CC(=O)[C@]1(CC[C@@H]2[C@@]1(CC[C@H]3[C@H]2C=C(C4=CC(=O)[C@@H]5C[C@@H]5[C@]34C)Cl)C)OC(=O)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/cyproterone-acetate.html |
