TAK-700 10mM * 1mL in DMSO
Orteronel (TAK700) is an androgen synthesis inhibitor. It selectively inhibits the enzyme CYP17A which is expressed in testicular, adrenal, and prostatic tumor tissues.
| Trivial name | TAK-700 10mM * 1mL in DMSO |
| Catalog Number | A13515-10mM-D |
| Alternative Name(s) | 6-(7-Hydroxy-6,7-dihydro-5H-pyrrolo[1,2-c]imidazol-7-yl)-N-methylnaphthalene-2-carboxamide |
| Molecular Formula | C28H28N4O7 |
| CAS# | 426219-53-6 |
| SMILES | CNC(=O)C1=CC2=C(C=C1)C=C(C=C2)C3(CCN4C3=CN=C4)O.C1=CC=C(C=C1)NC(=O)[C@H]([C@@H](C(=O)O)O)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tak-700-orteronel-9453.html |
