Orteronel
Orteronel(TAK-700) is a potent and highly selective human 17,20-lyase inhibitor with IC50 of 38 nM, exhibits >1000-fold selectivity over other CYPs (e.g. 11-hydroxylase and CYP3A4). TAK-700 (Orteronel) is an androgen biosynthesis inhibitor. Phase 3.
| Trivial name | TAK-700 |
| Catalog Number | S1195 |
| Molecular Formula | C22H25ClN6O4S |
| CAS# | 426219-18-3 |
| Inchi | InChI=1S/C22H25ClN6O4S/c1-32-20-13-15(29-9-11-33-12-10-29)7-8-19(20)26-22-24-14-16(23)21(27-22)25-17-5-3-4-6-18(17)28-34(2,30)31/h3-8,13-14,28H,9-12H2,1-2H3,(H2,24,25,26,27) |
| Inchi Key | CLGWUCNXOBLWFM-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N2CCOCC2)NC3=NC=C(C(=N3)NC4=CC=CC=C4NS(=O)(=O)C)Cl |
| Size | 5mg |
| Supplier Page | http://www.selleckchem.com/products/TAK-700.html |
| Additional Information | https://file.selleck.cn/downloads/struct/TAK-700-chemical-structure-s1195.gif |
