Semagacestat (LY450139) 10mM * 1mL in DMSO
Semagacestat (LY450139) is a ??-secretase blocker for A??42, A??40 and A??38 with IC50 of 10.9 nM, 12.1 nM and 12.0 nM, respectively. Semagacestat also inhibits Notch signaling with IC50 of 14.1 nM.
| Trivial name | Semagacestat (LY450139) 10mM * 1mL in DMSO |
| Catalog Number | A10836-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C19H27N3O4 |
| CAS# | 425386-60-3 |
| SMILES | C[C@@H](C(=O)N[C@H]1C2=CC=CC=C2CCN(C1=O)C)NC(=O)[C@H](C(C)C)O |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/semagacestat-ly450139.html |
