Flunixin meglumine 500mg
Flunixin meglumine (IC50 = 1 nM) can be used as a drug for animals for the management of intestinal ischaemia, colic, and endotoxemia in horses.
| Trivial name | Flunixin meglumine 500mg |
| Catalog Number | A11686-500 |
| Alternative Name(s) | 2-[[2-Methyl-3-(trifluoromethyl)phenyl]amino]-3-pyridinecarboxylic acid meglumine salt |
| Molecular Formula | C14H11F3N2O2.C7H17NO5 |
| CAS# | 42461-84-7 |
| SMILES | CC1=C(C=CC=C1NC2=C(C=CC=N2)C(=O)O)C(F)(F)F.CNC[C@@H]([C@H]([C@@H]([C@@H](CO)O)O)O)O |
| Size | 500mg |
| Supplier Page | http://www.adooq.com/flunixin-meglumin.html |