β-Alanine ethyl ester hydrochloride
β-Alanine ethyl ester is the ethyl ester of the non-essential amino acid β-alanine. It would be expected to hydrolyse within the body to form β-alanine.
| Catalog Number | 4244-84-2 |
| Alternative Name(s) | β-Ala-OEt HCl; 3-Aminopropionic acid ethyl ester hydrochloride; ethyl 3-aminopropanoate hydrochloride; beta-Alanine ethyl ester hydrochloride; H-beta-Ala-OEt HCl; Ethyl beta-alaninate hydrochloride; h-beta-ala-oet HCl; beta-alanine ethyl ester HCl; b-alanine ethyl ester hydrochloride; beta-alanine ethylester hydrochloride; H beta Ala OEt HCl |
| Molecular Formula | C5H11NO2·HCl |
| CAS# | 4244-84-2 |
| Purity | ≥99% |
| Inchi | InChI=1S/C5H11NO2.ClH/c1-2-8-5(7)3-4-6;/h2-4,6H2,1H3;1H |
| Inchi Key | RJCGNNHKSNIUAT-UHFFFAOYSA-N |
| Size | Please inquire |
| Supplier Page | https://aapep.bocsci.com/product/alanine-ethyl-ester-hydrochloride-cas-4244-84-2-68617.html |