Hesperadin 10mM * 1mL in DMSO
Hesperadin is a human Aurora B inhibitor with an IC50 of 40 nM for the prevention of the phosphorylation of substrate.
| Trivial name | Hesperadin 10mM * 1mL in DMSO |
| Catalog Number | A10448-10mM-D |
| Alternative Name(s) | N-[(3Z)-2-Oxo-3-[phenyl-[4-(piperidin-1-ylmethyl)anilino]methylidene]-1H-indol-5-yl]ethanesulfonamide |
| Molecular Formula | C29H32N4O3S |
| CAS# | 422513-13-1 |
| SMILES | CCS(=O)(=O)NC1=CC2=C(C=C1)NC(=O)/C2=C(/C3=CC=CC=C3)NC4=CC=C(C=C4)CN5CCCCC5 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/hesperadin.html |
