5-methoxyflavone
5-Methoxyflavone, belonged to Flavonoid family, is a DNA polymerase-beta inhibitor and neuroprotective agent against beta-amyloid toxicity. possess central nervous system (CNS) depressant effect mediated through the ionotropic GABAA receptors.
| Trivial name | / |
| Catalog Number | CSN23335 |
| Alternative Name(s) | / |
| Research Area | Neurological Disease |
| Molecular Formula | C16H12O3 |
| CAS# | 42079-78-7 |
| Purity | ≥98% |
| SMILES | O=C1C=C(C2=CC=CC=C2)OC3=C1C(OC)=CC=C3 |
| Size | 100mg |
| Supplier Page | https://www.csnpharm.com/products/5-methoxyflavone.html |