Clotrimazole EP Impurity C
2-Chlorotrityl Chloride is used in convergent peptide synthesis. 2-Chlorotrityl Chloride is also used in the preparation of modified trityl nucleosides as inhibitors of P. falciparum dUTPase.
| Catalog Number | CS-T-12742 |
| Alternative Name(s) | Clotrimazole EP Impurity C;2-Chlorotrityl Chloride;2-Chlorotritylchloride polymer resin;1-chloro-2-(chlorodiphenylmethyl)benzene |
| Molecular Formula | C19H14Cl2 |
| CAS# | 42074-68-0 |
| Purity | >98% |
| SMILES | ClC(C1=CC=CC=C1)(C2=CC=CC=C2)C(C=CC=C3)=C3Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST12742.html |