L-Arginine-DL-Malate(2:1)
L-arginine malate is a salt form of arginine, which is the nitrogen donor for synthesis of nitric oxide, a potent vasodilator that is deficient during times of sickle cell crisis.
| Catalog Number | PIPB-0783 |
| Alternative Name(s) | L-Arginine malate (S)-2-Amino-5-guanidinopentanoic acid 2-hydroxysuccinic acid (1:1) (2S)-2-amino-5-(diaminomethylideneamino)pentanoic acid;2-hydroxybutanedioic acid |
| Research Area | Peptide APIs |
| Molecular Formula | C10H20N4O7 |
| CAS# | 41989-03-1 |
| SMILES | C(CC(C(=O)O)N)CN=C(N)N.C(C(C(=O)O)O)C(=O)O |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/l-arginine-dl-malate21-item-12384.html |