Naproxen glucuronide | MedChemExpress (MCE)
Naproxen glucuronide ((S)-Naproxen-β-D-glucuronide) is a non-selective COX inhibitor. Naproxen glucuronide, a metabolite of naproxen, is a nonsteroidal anti-inflammatory drug (NSAID) of the propionic acid class (the same as ibuprofen) that relieves pain, fever, swelling, and stiffness[1].
| Trivial name | Naproxen glucuronide |
| Catalog Number | HY-W121901 |
| Alternative Name(s) | (S)-Naproxen-β-D-glucuronide |
| Research Area | Inflammation/Immunology |
| CAS# | 41945-43-1 |
| Purity | ≥98.0% |
| SMILES | OC([C@H]([C@H]([C@@H]([C@H]1O)O)O)O[C@H]1OC([C@H](C2=CC3=C(C=C2)C=C(C=C3)OC)C)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/naproxen-glucuronide.html |