Bezafibrate
Bezafibrate is the agonist of PPAR and the EC50 for PPAR⍺, PPARβ, PPARγ is 50 , 20, and 60 nM respectively. It has hypolipidemic effect.
| Trivial name | BM 15075 |
| Catalog Number | CSN10445 |
| Alternative Name(s) | BM 15075 |
| Research Area | Cardiovascular Disease |
| Molecular Formula | C19H20ClNO4 |
| CAS# | 41859-67-0 |
| Purity | ≥99% |
| SMILES | CC(C)(OC1=CC=C(CCNC(C2=CC=C(Cl)C=C2)=O)C=C1)C(O)=O |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/bezafibrate.html |
