Lenvatinib D4
Stable Isotopes
| Trivial name | NULL |
| Catalog Number | CS-O-16637 |
| Alternative Name(s) | 4-[3-chloro-4-({[(2,2,3,3-D4)cyclopropyl]carbamoyl}amino)phenoxy]-7-methoxyquinoline-6-carboxamide |
| Research Area | Labeled Lenvatinib, intended for use as an internal standard for the quantification of Lenvatinib by GC- or LC-mass spectrometry. |
| Molecular Formula | C21H15D4ClN4O4 |
| CAS# | 417716-92-8 (Unlabeled) |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | ClC1=C(NC(NC2([2H])C([2H])([2H])C2([2H])[2H])=O)C=CC(OC3=CC=NC4=C3C=C(C(N)=O)C(OC)=C4)=C1 |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO16637.html |
| Additional Information | NULL |