16,16-Dimethyl prostaglandin A1 | MedChemExpress (MCE)
16,16-Dimethyl prostaglandin A1 (di-Me-PGA1) is a prostaglandin analog that can inhibit DNA synthesis in Lewis lung carcinoma and B 16 amelanotic melanoma cells. 16,16-Dimethyl prostaglandin A1 also inhibits viral replication in both HSV and HIV-1 infection systems[1][2].
| Trivial name | 16,16-Dimethyl prostaglandin A1 |
| Catalog Number | HY-116758 |
| Alternative Name(s) | di-Me-PGA1 |
| Research Area | Infection; Cancer |
| CAS# | 41692-24-4 |
| Purity | ≥98.0% |
| SMILES | CCCCC(C)(C)[C@H](O)/C=C/[C@@H]1[C@H](C(C=C1)=O)CCCCCCC(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/16-16-dimethyl-prostaglandin-a1.html |