16,16-Dimethyl PGA2 | MedChemExpress (MCE)
16,16-Dimethyl PGA2 is an orally active prostaglandin analog with a prolonged in vivo half-life. 16,16-Dimethyl PGA2 can be used to study hypertension[1].
| Trivial name | 16,16-Dimethyl PGA2 |
| Catalog Number | HY-137270 |
| Alternative Name(s) | 16,16-Dimethyl prostaglandin A2; Di-M-PGA2 |
| Research Area | Endocrinology; Cancer |
| CAS# | 41691-92-3 |
| Purity | ≥98.0% |
| SMILES | O[C@@H](C(C)(C)CCCC)/C=C/[C@@H](C=CC1=O)[C@H]1C/C=C\CCCC(O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/16-16-dimethyl-pga2.html |