Aniline D5
Deuterated Building Blocks
| Trivial name | NULL |
| Catalog Number | CS-T-48261 |
| Alternative Name(s) | Benzen-2,3,4,5,6-d5-amine; 2,3,4,5,6-Pentadeuteroaniline; Phenyl-d5 amine. |
| Research Area | Labeled Aniline, intended for use as an internal standard for the quantification of Aniline by GC- or LC-mass spectrometry. |
| Molecular Formula | C6H2D5N |
| CAS# | 4165-61-1 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | NC(C([2H])=C1[2H])=C(C([2H])=C1[2H])[2H] |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CST48261.html |
| Additional Information | NULL |