(-)-Pinoresinol 4-O-glucoside | MedChemExpress (MCE)
(-)-Pinoresinol 4-O-glucoside ((-)-Pinoresinol 4-O-β-D-glucopyranoside) is a potent and orally active α-glucosidase inhibitor with an IC50 value of 48.13 µM. (-)-Pinoresinol 4-O-glucoside increases cell migration and early differentiation of pre-osteoblasts. (-)-Pinoresinol 4-O-glucoside increases protein level of BMP2, p-Smad1/5/8, RUNX2. (-)-Pinoresinol 4-O-glucoside attenuates oxidative stress, hyperglycemia and hepatic toxicity. (-)-Pinoresinol 4-O-glucoside has the potential for the research of osteoporosis and periodontal disease[1][2].
| Trivial name | (-)-Pinoresinol 4-O-glucoside |
| Catalog Number | HY-N0946 |
| Alternative Name(s) | (-)-Pinoresinol 4-O-β-D-glucopyranoside |
| Research Area | Metabolic Disease |
| CAS# | 41607-20-9 |
| Purity | ≥98.00% |
| SMILES | O[C@H]([C@H]([C@@H]([C@@H](CO)O1)O)O)[C@@H]1OC2=CC=C([C@@H]3OC[C@]4([H])[C@@]3([H])CO[C@H]4C5=CC=C(O)C(OC)=C5)C=C2OC |
| PubChem Chemical Structure ID | 11168362 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/minus-pinoresinol-4-o-glucoside.html |