Belinostat (PXD101) 10mM * 1mL in DMSO
Belinostat (PXD101) is a HDAC inhibitor that inhibits HDAC activity in HeLa cell extracts with an IC50 of 27 nM.
Trivial name | Belinostat (PXD101) 10mM * 1mL in DMSO |
Catalog Number | A10122-10mM-D |
Alternative Name(s) | (2E)-N-Hydroxy-3-[3-(phenylsulfamoyl)phenyl]prop-2-enamide |
Molecular Formula | C15H14N2O4S |
CAS# | 414864-00-9 |
SMILES | C1=CC=C(C=C1)NS(=O)(=O)C2=CC=CC(=C2)/C=C/C(=O)NO |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/belinostat-pxd101.html |