Alfacalcidol
A synthetic analog of Calcitiol (the hormonal form of vitamin D3), which shows identical potency with respect to stimulation of intestinal calcium absorption and bone mineral mobilization. Vitamin D source.;Impurity in commercial preparations of Alfacalcidol
| Catalog Number | CS-O-00811 |
| Alternative Name(s) | 5-[(2E)-2-[(1R,3aS,7aR)-1-[(1R)-1,5-Dimethylhexyyl-;(1R,3S,Z)-5-((E)-2-((1R,3aS,7aR)-7a-methyl-1-((R)-6-methylheptan-2-yl)hexahydro-1H-inden-4(2H)-ylidene)ethylidene)-4-methylenecyclohexane-1,3-diol |
| Molecular Formula | C27H44O2 |
| CAS# | 41294-56-8 |
| Purity | >98% |
| SMILES | C[C@]([C@@]1([H])[C@H](C)CCCC(C)C)(CCC/2)[C@](CC1)([H])C2=CC=C(C[C@@H](O)C[C@@H]3O)/C3=C |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO00811.html |