TIC10 10mM * 1mL in DMSO
TIC10 inactivates Akt and ERK to induce TRAIL through Foxo3a, possesses superior drug properties: delivery across the blood-brain barrier, superior stability and improved pharmacokinetics.
| Trivial name | TIC10 10mM * 1mL in DMSO |
| Catalog Number | A12720-10mM-D |
| Alternative Name(s) | 7-benzyl-10-(2-methylbenzyl)-2,3,6,7,8,9-hexahydroimidazo[1,2-a]pyrido[4,3-d]pyrimidin-5(10H)-one |
| Molecular Formula | C24H26N4O |
| CAS# | 41276-02-2 |
| SMILES | CC1=CC=CC=C1CN2C3=C(CN(CC3)CC4=CC=CC=C4)C(=O)N5C2=NCC5 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tic10.html |
