Memantine hydrochloride 10mM * 1mL in DMSO
Memantine hydrochloride is an antagonist at the NMDA receptor, binding to the ion channel site. it was used in the treatment of Parkinsonism.
| Trivial name | Memantine hydrochloride 10mM * 1mL in DMSO |
| Catalog Number | A11708-10mM-D |
| Alternative Name(s) | N/A |
| Molecular Formula | C12H21N.HCl |
| CAS# | 41100-52-1 |
| SMILES | CC12CC3CC(C1)(CC(C3)(C2)N)C.Cl |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/memantine-hydrochloride.html |