Apramycin Sulfate
Apramycin sulfate is an aminoglycoside antibiotic and has a bactericidal action against many Gram-negative bacteria. Apramycin is a structurally unique antibiotic that contains a bicyclic sugar moiety and a monosubstituted deoxystreptamine. It is not approved for use in humans.
| Trivial name | / |
| Catalog Number | CSN10323 |
| Alternative Name(s) | / |
| Research Area | Infection |
| Molecular Formula | C21H43N5O15S |
| CAS# | 410097-64-2 |
| SMILES | O=S(O)(O)=O.OC[C@H]([C@H]([C@@H]([C@H]1O)O)N)O[C@@H]1O[C@H]2O[C@H]3C[C@@H](N)[C@@H](O[C@@H]4[C@H](C[C@H]([C@@H]([C@H]4O)O)N)N)O[C@@H]3[C@H](O)[C@@H]2NC |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/apramycin-sulfate.html |
