H2DCFDA
H2DCFDA, a cell-permeable fluorogenic probe, is useful to detect reactive oxygen species (ROS) and nitric oxide thus determinate the degree of oxidative stress.
| Trivial name | DCFH; DCFH-DA; 2,7-Dichlorodihydrofluorescein diacetate; 2′,7′-Dichlorofluorescin diacetate |
| Catalog Number | CSN21114 |
| Alternative Name(s) | DCFH; DCFH-DA; 2,7-Dichlorodihydrofluorescein diacetate; 2′,7′-Dichlorofluorescin diacetate |
| Research Area | / |
| Molecular Formula | C24H16Cl2O7 |
| CAS# | 4091-99-0 |
| Purity | ≥97% |
| SMILES | O=C(O)C1=CC=CC=C1C2C3=C(OC4=C2C=C(Cl)C(OC(C)=O)=C4)C=C(OC(C)=O)C(Cl)=C3 |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/h2dcfda.html |