H2DCFDA
H2DCFDA, a cell-permeable fluorogenic probe, is useful to detect reactive oxygen species (ROS) and nitric oxide thus determinate the degree of oxidative stress.

Trivial name | DCFH; DCFH-DA; 2,7-Dichlorodihydrofluorescein diacetate; 2′,7′-Dichlorofluorescin diacetate |
Catalog Number | CSN21114 |
Alternative Name(s) | DCFH; DCFH-DA; 2,7-Dichlorodihydrofluorescein diacetate; 2′,7′-Dichlorofluorescin diacetate |
Research Area | / |
Molecular Formula | C24H16Cl2O7 |
CAS# | 4091-99-0 |
Purity | ≥97% |
SMILES | O=C(O)C1=CC=CC=C1C2C3=C(OC4=C2C=C(Cl)C(OC(C)=O)=C4)C=C(OC(C)=O)C(Cl)=C3 |
Size | 50mg |
Supplier Page | https://www.csnpharm.com/products/h2dcfda.html |