Salubrinal 10mM * 1mL in DMSO
Salubrinal is a cell-permeable, selective inhibitor of cellular phosphatase complexes that dephosphorylate eukaryotic translation initiation factor 2 subunit ?? (eIF2??). Protects cells from endoplasmic reticulum stress-induced apoptosis (EC50 ~ 15 ??M).
| Trivial name | Salubrinal 10mM * 1mL in DMSO |
| Catalog Number | A12676-10mM-D |
| Alternative Name(s) | 3-Phenyl-N-[2,2,2-trichloro-1-[[(8-?quinolinylamino)thioxomethyl]amino]ethyl]-2-propen?amide |
| Molecular Formula | C21H17N4OSCl3 |
| CAS# | 405060-95-9 |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)NC(C(Cl)(Cl)Cl)NC(=S)NC2=CC=CC3=C2N=CC=C3 |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/salubrinal.html |
