N-Desmethyl Imatinib
A metabolite of Gleevec, a tyrosine kinase inhibitor which is highly specific for BCR-ABL, the enzyme associated with chronic myelogenous leukemia (CML) and certain forms of acute lymphoblastic leukemia (ALL).
| Catalog Number | CS-O-05955 |
| Alternative Name(s) | Imatinib N-Desmethyl Impurity;Imatinib Impurity F;N-[4-Methyl-3-[[4-(3-pyridinyl)-2-pyrimidinyl]amino]phenyl]-4-(1-piperazinylmethyl)-benzamide; N-Desmethyl Gle9-00;CS-O-32360 |
| Research Area | Metabolites |
| Molecular Formula | C28H29N7O |
| CAS# | 404844-02-6 |
| Purity | >98% |
| SMILES | CC1=CC=C(NC(C2=CC=C(CN3CCNCC3)C=C2)=O)C=C1NC4=NC=CC(C5=CN=CC=C5)=N4 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05955.html |
