Yatein
Yatein, a lignan precursor of podophyllotoxin isolated and purified from the leaves of Chamaecyparis obtusa, is a key agent in anticancer drugs and can significantly suppress HSV-1 multiplication in HeLa cells without apparent cytotoxicity.
| Trivial name | / |
| Catalog Number | CSN14354 |
| Alternative Name(s) | / |
| Research Area | / |
| Molecular Formula | C22H24O7 |
| CAS# | 40456-50-6 |
| Purity | ≥98% |
| SMILES | O=C1OC[C@H](CC2=CC=C(OCO3)C3=C2)[C@H]1CC4=CC(OC)=C(OC)C(OC)=C4 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/yatein.html |