Pamidronic acid 100mg
Pamidronic acid is a nitrogen containing bisphosphonate, used to prevent osteoporosis. It is also used to strengthen bone in Paget’s disease, to prevent bone loss due to steroid use, and in certain cancers with high propensity to bone, such as multiple myeloma.
Trivial name | Pamidronic acid 100mg |
Catalog Number | A11685-100 |
Alternative Name(s) | (3-amino-1-hydroxypropane-1,1-diyl)bis(phosphonic acid) |
Molecular Formula | C₃H₁₁NO₇P₂ |
CAS# | 40391-99-9 |
SMILES | C(CN)C(O)(P(=O)(O)O)P(=O)(O)O |
Size | 100mg |
Supplier Page | http://www.adooq.com/pamidronic-acid.html |