SB 399885 HCl 50mg
SB 399885 hydrochloride is a potent, brain penetrant, and orally active SR-6 antagonist. It displays > 200-fold selectivity for SR-6 over other serotonin receptors (pKi values are 9.11, 8.81 and 9.02 for human recombinant, native rat and native human SR-6 receptors, respectively).
| Trivial name | SB 399885 HCl 50mg |
| Catalog Number | A14102-50 |
| Alternative Name(s) | N-(3,5-Dichloro-2-methoxyphenyl)-4-methoxy-3-(1-piperazinyl)benzenesulfonamide hydrochloride |
| Molecular Formula | C18H21Cl2N3O4S |
| CAS# | 402713-80-8 |
| SMILES | COC1=C(C=C(C=C1)S(=O)(=O)NC2=CC(=CC(=C2OC)Cl)Cl)N3CCNCC3.Cl |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/sb-399885-hcl.html |
