Methacycline HCl
Methacycline HCl is a tetracycline antibiotic active against most Gram-positive bacteria and Gram-negative bacteria, acting through inhibiting the binding of aminoacyl-tRNA to the mRNA-ribosome complex thereby inhibiting protein synthesis.
| Trivial name | Rondomycin |
| Catalog Number | CSN11391 |
| Alternative Name(s) | Rondomycin |
| Research Area | Infection |
| Molecular Formula | C22H23ClN2O8 |
| CAS# | 3963-95-9 |
| Purity | ≥98% |
| SMILES | O[C@@](C(O)=C(C(C1=C2C=CC=C1O)=O)[C@](C2=C)([H])[C@@H]3O)(C(C(C(N)=O)=C4O)=O)[C@]3([H])[C@@H]4N(C)C.Cl |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/methacycline-hcl.html |
