Triamterene
API Standard
| Catalog Number | CS-O-02496 |
| Alternative Name(s) | 6-phenylpteridine-2,4,7-triamine |
| Research Area | Triamterene is a pteridine derivative with potassium-sparing diuretic property. Triamterene blocks the sodium-potassium exchange pump (Na-K-ATPase) in the luminal membrane of principal cells in the late distal tubule, cortical collecting tubule and collec |
| Molecular Formula | C12H11N7 |
| CAS# | 396-01-0 |
| Purity | >98% |
| SMILES | NC1=NC(N)=NC2=NC(N)=C(C3=CC=CC=C3)N=C12 |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO02496.html |