Phenamacril | MedChemExpress (MCE)
Phenamacril (JS399-19) inhibits activity of myosin I non-competitively with an IC50 of 360 nM through suppression of the ATPase activity, exhibits therefore an antifungal efficacy towards Fusarium species[1].
| Trivial name | Phenamacril |
| Catalog Number | HY-122200 |
| Alternative Name(s) | JS399-19 |
| Research Area | Infection |
| CAS# | 39491-78-6 |
| Purity | ≥98.0% |
| SMILES | N#C/C(C(OCC)=O)=C(C1=CC=CC=C1)/N |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/phenamacril.html |