Methyl Vanillate
Methyl vanillate has ability to increase bone mass and activate wnt/β-catenin pathway. It can act as a potential lead anabolic agent for anti-osteoporosis drugs.
| Trivial name | Methyl 4-hydroxy-3-methoxybenzoate |
| Catalog Number | CSN23594 |
| Alternative Name(s) | Methyl 4-hydroxy-3-methoxybenzoate |
| Research Area | / |
| Molecular Formula | C9H10O4 |
| CAS# | 3943-74-6 |
| Purity | ≥99% |
| SMILES | COC(=O)C1=CC(OC)=C(O)C=C1 |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/methyl-vanillate.html |