Kamebanin | MedChemExpress (MCE)
Kamebanin can be isolated from the leaves of Isodon weisiensis C. Y. Wu. Kamebanin has anti-proliferative activity and can be used in cancer research[1].
| Trivial name | Kamebanin |
| Catalog Number | HY-N3428 |
| Research Area | Cancer |
| CAS# | 39388-57-3 |
| Purity | ≥98.00% |
| SMILES | O[C@H]1[C@](C2=O)([C@@H](C[C@]3([H])C4(C)C)O)[C@](CC[C@@]1([H])C2=C)([H])[C@@]3([C@H](CC4)O)C |
| PubChem Chemical Structure ID | 168476199 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/kamebanin.html |