Lubabegron fumarate | MedChemExpress (MCE)
Lubabegron (LY-488756) fumarate is an antagonist of the adrenergic receptor (β-AR). Lubabegron fumarate can antagonize the stimulatory effects of β1-AR and β2-AR agonists on lipase respectively[1].
| Trivial name | Lubabegron fumarate |
| Catalog Number | HY-123012A |
| Alternative Name(s) | LY-591281; LY-488756 fumarate |
| Research Area | Metabolic Disease |
| CAS# | 391926-19-5 |
| Purity | ≥98.00% |
| SMILES | OC(/C=C/C(O)=O)=O.N#CC1=C(N=CC=C1)OC2=CC=C(C=C2)CC(NC[C@H](O)COC3=C(C4=CC=CS4)C=CC=C3)(C)C |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/lubabegron-fumarate.html |